|
تفاصيل المنتج:
|
| اسم المنتج: | ثنائي سيكلوهكسيل فينيل فوسفين | CAS: | 6476-37-5 |
|---|---|---|---|
| اينكس: | 229-334-7 | نقطة الانصهار: | 60-61 درجة مئوية (مضاءة) |
| درجة حرارة التخزين: | 2-8 درجة مئوية، يحفظ بعيداً عن الضوء، يخزن تحت النيتروجين | استمارة: | مسحوق بلوري |
| لون: | الأبيض إلى الأبيض | ||
| إبراز: | Dicyclohexylphenylphosphine biological reagents,CAS6476-37-5 industrial fine chemicals,Dicyclohexylphenylphosphine with warranty,CAS6476-37-5 industrial fine chemicals,Dicyclohexylphenylphosphine with warranty |
||
CAS6476-37-5 Dicyclohexylphenylphosphine biological reagents
| Product Name: | Dicyclohexylphenylphosphine |
| Synonyms: | dicyclohexylphenyl-phosphin;phenyldicyclohexylphosphine;Phosphine, dicyclohexylphenyl-;DICYCLOHEXYLPHENYLPHOSPHINE;PHENYLPHOSPHINODICYCLOHEXANE;Dicyclohexyphenylphosphine;PHENYLDICYCLOHEXYLPHOSPHINE(PHPCY2);dicyclohexylphenylphosphine95+% |
| CAS: | 6476-37-5 |
| MF: | C18H27P |
| MW: | 274.38 |
| EINECS: | 229-334-7 |
| Product Categories: | Achiral Phosphine;Aryl Phosphine;Mitsunobu Reaction;Phosphine Ligands;Phosphines (Mitsunobu Reaction);Synthetic Organic Chemistry;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds |
| Mol File: | 6476-37-5.mol |
 |
|
| Dicyclohexylphenylphosphine Chemical Properties |
| Melting point | 60-61 °C (lit.) |
| Boiling point | 391.8±11.0 °C(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1 |
| CAS DataBase Reference | 6476-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Dicyclohexylphenylphosphine(6476-37-5) |
| EPA Substance Registry System | Phosphine, dicyclohexylphenyl- (6476-37-5) |
|
|
اتصل شخص: Maggie Ma
الهاتف :: +0086 188 7414 9531
Arabic
