|
تفاصيل المنتج:
|
| اسم المنتج: | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-ثنائي هيدريد حمض رباعي الكربوكسيل | CAS: | 1719-83-1 |
|---|---|---|---|
| اينكس: | 217-009-2 | نقطة الانصهار: | > 300 درجة مئوية (مضاءة) |
| درجة حرارة التخزين: | متجر أقل من +30 درجة مئوية. | استمارة: | مسحوق إلى بلور |
| لون: | أبيض إلى أبيض تقريبا | ||
| إبراز: | Bicyclo octene tetracarboxylic acid dianhydride industrial chemical,CAS 1719-83-1 fine chemical factory,Industrial fine chemicals with warranty,CAS 1719-83-1 fine chemical factory,Industrial fine chemicals with warranty |
||
| Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Basic information |
| Product Name: | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride |
| Synonyms: | 4,10-DIOXATETRACYCLO[5.5.2.0(2,6).0(8,12)]TETRADEC-13-ENE-3,5,9,11-TETRAONE;Bicyclooctenetetracarboxylicaciddianhydride;BICYCLO[2.2.2]OCT-7-ENE-2,3,5,6-TETRACARBOYLIC ACID DIANHYDRIDE;bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydrid;Bicyclo2.2.2üoct-7-ene-2,3,5,6-tetracarboxylic dianhydride, 97%;3,6-Ethenocyclohexane-1,2,4,5-tetracarboxylic acid 1,2:4,5-dianhydride;3a,4,4a,7a,8,8a-Hexahydro-4,8-etheno-1H,3H-benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone;Bicyclo[2.2.2]octa-2-ene-5,6,7,8-tetracarboxylic acid 5,6:7,8-dianhydride |
| CAS: | 1719-83-1 |
| MF: | C12H8O6 |
| MW: | 248.19 |
| EINECS: | 217-009-2 |
| Product Categories: | Anhydride Monomers;Monomers;Polymer Science;Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;PI |
| Mol File: | 1719-83-1.mol |
| Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride Chemical Properties |
| Melting point | >300 °C(lit.) |
| Boiling point | 351.26°C (rough estimate) |
| density | 1.4501 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water |
| Sensitive | Moisture Sensitive |
| BRN | 294213 |
| InChI | InChI=1S/C12H8O6/c13-9-5-3-1-2-4(7(5)11(15)17-9)8-6(3)10(14)18-12(8)16/h1-8H |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C=CC(C4C(=O)OC(=O)C43)C2C1=O |
| CAS DataBase Reference | 1719-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic acid dianhydride(1719-83-1) |
![]()
اتصل شخص: Maggie Ma
الهاتف :: +0086 188 7414 9531