|
تفاصيل المنتج:
|
| اسم المنتج: | ميتاكريلات الزنك | كاس: | 13189-00-9 |
|---|---|---|---|
| اينكس: | 236-144-8 | نقطة الانصهار: | 229-232 درجة مئوية (مضاءة) |
| درجة حرارة التخزين.: | جو خامل ، درجة حرارة الغرفة | استمارة: | مسحوق |
| لون: | أبيض | ||
| إبراز: | Zinc methacrylate lab reagent,CAS 13189-00-9 biochemical reagent,Industrial fine chemical zinc methacrylate,CAS 13189-00-9 biochemical reagent,Industrial fine chemical zinc methacrylate |
||
CAS 13189-00-9 Zinc methacrylate biochemical reagent for labs
| Product Name: | Zinc methacrylate |
| Synonyms: | 2-Propenoicacid,2-methyl-,zincsalt;METHACRYLIC ACID, ZINC SALT;Zinc methacrylate, 97%+;2-Methyl-2-propenoic acid, zinc salt;ZINC METHACRYLATE;ZINC DIMETHACRYLATE;Bis(methacrylic acid) zinc salt;Bis(methacryloyloxy) zinc |
| CAS: | 13189-00-9 |
| MF: | C8H10O4Zn |
| MW: | 235.55 |
| EINECS: | 236-144-8 |
| Product Categories: | Organic-metal salt;13189-00-9 |
| Mol File: | 13189-00-9.mol |
 |
|
| Zinc methacrylate Chemical Properties |
| Melting point | 229-232 °C(lit.) |
| density | 1,4 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Specific Gravity | 1.48 |
| Appearance | White to off-white Solid |
| Water Solubility | 100mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C4H6O2.Zn/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | C(=O)(O[Zn]OC(=O)C(=C)C)C(=C)C |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 13189-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc dimethacrylate (13189-00-9) |
اتصل شخص: Maggie Ma
الهاتف :: +0086 188 7414 9531
